C12H10Br4N2O2S — CID 56968173
ethyl 3-[(4,5,6,7-tetrabromo-1H-benzimidazol-2-yl)sulfanyl]propanoate (PubChem CID 56968173) has the molecular formula C12H10Br4N2O2S and a molecular weight of 565.91 g/mol. Its IUPAC name is ethyl 3-[(4,5,6,7-tetrabromo-1H-benzimidazol-2-yl)sulfanyl]propanoate.
| Compound Name | ethyl 3-[(4,5,6,7-tetrabromo-1H-benzimidazol-2-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 56968173 |
| Molecular Formula | C12H10Br4N2O2S |
| Molecular Weight | 565.91 g/mol |
| Exact Mass | 561.72 |
| IUPAC Name | ethyl 3-[(4,5,6,7-tetrabromo-1H-benzimidazol-2-yl)sulfanyl]propanoate |
| SMILES | CCOC(=O)CCSc1nc2c(Br)c(Br)c(Br)c(Br)c2[nH]1 |
| InChI | InChI=1S/C12H10Br4N2O2S/c1-2-20-5(19)3-4-21-12-17-10-8(15)6(13)7(14)9(16)11(10)18-12/h2-4H2,1H3,(H,17,18) |
| InChIKey | PVKXBVFJITVOTN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.91 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|