C13H12Br4N2O2S — CID 57391986
ethyl 3-(4,5,6,7-tetrabromo-1-methylbenzimidazol-2-yl)sulfanylpropanoate (PubChem CID 57391986) has the molecular formula C13H12Br4N2O2S and a molecular weight of 579.93 g/mol. Its IUPAC name is ethyl 3-(4,5,6,7-tetrabromo-1-methylbenzimidazol-2-yl)sulfanylpropanoate.
| Compound Name | ethyl 3-(4,5,6,7-tetrabromo-1-methylbenzimidazol-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 57391986 |
| Molecular Formula | C13H12Br4N2O2S |
| Molecular Weight | 579.93 g/mol |
| Exact Mass | 575.74 |
| IUPAC Name | ethyl 3-(4,5,6,7-tetrabromo-1-methylbenzimidazol-2-yl)sulfanylpropanoate |
| SMILES | CCOC(=O)CCSc1nc2c(Br)c(Br)c(Br)c(Br)c2n1C |
| InChI | InChI=1S/C13H12Br4N2O2S/c1-3-21-6(20)4-5-22-13-18-11-9(16)7(14)8(15)10(17)12(11)19(13)2/h3-5H2,1-2H3 |
| InChIKey | QCNGIVOPZFUFFZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.93 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|