C24H39N3O6S3 — CID 110189218
butyl 3-[[4,6-bis[(3-butoxy-3-oxopropyl)sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]propanoate (PubChem CID 110189218) has the molecular formula C24H39N3O6S3 and a molecular weight of 561.79 g/mol. Its IUPAC name is butyl 3-[[4,6-bis[(3-butoxy-3-oxopropyl)sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]propanoate.
| Compound Name | butyl 3-[[4,6-bis[(3-butoxy-3-oxopropyl)sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 110189218 |
| Molecular Formula | C24H39N3O6S3 |
| Molecular Weight | 561.79 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | butyl 3-[[4,6-bis[(3-butoxy-3-oxopropyl)sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]propanoate |
| SMILES | CCCCOC(=O)CCSc1nc(SCCC(=O)OCCCC)nc(SCCC(=O)OCCCC)n1 |
| InChI | InChI=1S/C24H39N3O6S3/c1-4-7-13-31-19(28)10-16-34-22-25-23(35-17-11-20(29)32-14-8-5-2)27-24(26-22)36-18-12-21(30)33-15-9-6-3/h4-18H2,1-3H3 |
| InChIKey | LTNUALYAMGRUTR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.79 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|