C12H21N5O2S — CID 118921677
butyl 3-[[4-(2-aminoethylamino)-1,3,5-triazin-2-yl]sulfanyl]propanoate (PubChem CID 118921677) has the molecular formula C12H21N5O2S and a molecular weight of 299.40 g/mol. Its IUPAC name is butyl 3-[[4-(2-aminoethylamino)-1,3,5-triazin-2-yl]sulfanyl]propanoate.
| Compound Name | butyl 3-[[4-(2-aminoethylamino)-1,3,5-triazin-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 118921677 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | butyl 3-[[4-(2-aminoethylamino)-1,3,5-triazin-2-yl]sulfanyl]propanoate |
| SMILES | CCCCOC(=O)CCSc1ncnc(NCCN)n1 |
| InChI | InChI=1S/C12H21N5O2S/c1-2-3-7-19-10(18)4-8-20-12-16-9-15-11(17-12)14-6-5-13/h9H,2-8,13H2,1H3,(H,14,15,16,17) |
| InChIKey | YBVKNJWLELQWDO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|