C11H14N4O2S — CID 66339533
hydrazinyl 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]propanoate (PubChem CID 66339533) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is hydrazinyl 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]propanoate.
| Compound Name | hydrazinyl 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 66339533 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | hydrazinyl 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]propanoate |
| SMILES | Cc1ccc2nc(SCCC(=O)ONN)[nH]c2c1 |
| InChI | InChI=1S/C11H14N4O2S/c1-7-2-3-8-9(6-7)14-11(13-8)18-5-4-10(16)17-15-12/h2-3,6,15H,4-5,12H2,1H3,(H,13,14) |
| InChIKey | GUHFLNBXKQZSBQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|