C13H14N2O3S — CID 69139924
ethyl 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-2-oxopropanoate (PubChem CID 69139924) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is ethyl 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-2-oxopropanoate.
| Compound Name | ethyl 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-2-oxopropanoate |
|---|---|
| PubChem CID | 69139924 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | ethyl 3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)CSc1nc2ccc(C)cc2[nH]1 |
| InChI | InChI=1S/C13H14N2O3S/c1-3-18-12(17)11(16)7-19-13-14-9-5-4-8(2)6-10(9)15-13/h4-6H,3,7H2,1-2H3,(H,14,15) |
| InChIKey | JEZTXSYLLKKVEC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|