C8H12N2O2S — CID 103761124
3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide (PubChem CID 103761124) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide.
| Compound Name | 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 103761124 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]propanamide |
| SMILES | Cc1nc(SCCC(N)=O)oc1C |
| InChI | InChI=1S/C8H12N2O2S/c1-5-6(2)12-8(10-5)13-4-3-7(9)11/h3-4H2,1-2H3,(H2,9,11) |
| InChIKey | WAFVHEVOTDKWQJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |