C10H17N3O2S — CID 106926298
5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]pentanehydrazide (PubChem CID 106926298) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]pentanehydrazide.
| Compound Name | 5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]pentanehydrazide |
|---|---|
| PubChem CID | 106926298 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]pentanehydrazide |
| SMILES | Cc1nc(SCCCCC(=O)NN)oc1C |
| InChI | InChI=1S/C10H17N3O2S/c1-7-8(2)15-10(12-7)16-6-4-3-5-9(14)13-11/h3-6,11H2,1-2H3,(H,13,14) |
| InChIKey | FEQHVHNKGVWFKV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|