C9H15N3O2S — CID 106926315
2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]butanehydrazide (PubChem CID 106926315) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]butanehydrazide.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]butanehydrazide |
|---|---|
| PubChem CID | 106926315 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]butanehydrazide |
| SMILES | CCC(Sc1nc(C)c(C)o1)C(=O)NN |
| InChI | InChI=1S/C9H15N3O2S/c1-4-7(8(13)12-10)15-9-11-5(2)6(3)14-9/h7H,4,10H2,1-3H3,(H,12,13) |
| InChIKey | VHPJWFKFMZJUKP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|