C6H11N5OS2 — CID 63580902
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]butanehydrazide (PubChem CID 63580902) has the molecular formula C6H11N5OS2 and a molecular weight of 233.32 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]butanehydrazide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]butanehydrazide |
|---|---|
| PubChem CID | 63580902 |
| Molecular Formula | C6H11N5OS2 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]butanehydrazide |
| SMILES | CCC(Sc1nnc(N)s1)C(=O)NN |
| InChI | InChI=1S/C6H11N5OS2/c1-2-3(4(12)9-8)13-6-11-10-5(7)14-6/h3H,2,8H2,1H3,(H2,7,10)(H,9,12) |
| InChIKey | YFZIDBTWHQSEJC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|