About propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate
propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate (PubChem CID 19199985) has the molecular formula C8H13N3O2S2
and a molecular weight of 247.34 g/mol. Its IUPAC name is propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate.
Analyze propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
The IUPAC name of propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate (CID 19199985) is propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate.
What is the SMILES notation for propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
The canonical SMILES for propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate is CCCOC(=O)C(C)Sc1nnc(N)s1.
What is the InChIKey of propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
The InChIKey is PXHOAHBFHLENRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2S2/c1-3-4-13-6(12)5(2)14-8-11-10-7(9)15-8/h5H,3-4H2,1-2H3,(H2,9,10).
What are the key properties of propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate has a molecular weight of 247.34 g/mol, XLogP of 1.55, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate is sourced from PubChem (CID 19199985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).