2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid

C5H7N3O2S2 — CID 45134919

IUPAC2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid
SMILESCC(Sc1nnc(N)s1)C(=O)O
InChIInChI=1S/C5H7N3O2S2/c1-2(3(9)10)11-5-8-7-4(6)12-5/h2H,1H3,(H2,6,7)(H,9,10)
InChIKeyQRAIOWDNXKGEFD-UHFFFAOYSA-N
MW205.26 g/mol
LogP0.69
Rot. Bonds3

About 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid

2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid (PubChem CID 45134919) has the molecular formula C5H7N3O2S2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid.

Molecular Properties

Compound Name2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid
PubChem CID45134919
Molecular FormulaC5H7N3O2S2
Molecular Weight205.26 g/mol
Exact Mass205.00
IUPAC Name2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid
SMILESCC(Sc1nnc(N)s1)C(=O)O
InChIInChI=1S/C5H7N3O2S2/c1-2(3(9)10)11-5-8-7-4(6)12-5/h2H,1H3,(H2,6,7)(H,9,10)
InChIKeyQRAIOWDNXKGEFD-UHFFFAOYSA-N
XLogP0.69
TPSA89.10 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.26
LogP ≤ 50.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid?
The IUPAC name of 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid (CID 45134919) is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid.
What is the SMILES notation for 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid?
The canonical SMILES for 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid is CC(Sc1nnc(N)s1)C(=O)O.
What is the InChIKey of 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid?
The InChIKey is QRAIOWDNXKGEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2S2/c1-2(3(9)10)11-5-8-7-4(6)12-5/h2H,1H3,(H2,6,7)(H,9,10).
What are the key properties of 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid?
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid has a molecular weight of 205.26 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid is sourced from PubChem (CID 45134919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).