About ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate
ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate (PubChem CID 3170095) has the molecular formula C8H12N2O2S2
and a molecular weight of 232.33 g/mol. Its IUPAC name is ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate.
Analyze ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
The IUPAC name of ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate (CID 3170095) is ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate.
What is the SMILES notation for ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
The canonical SMILES for ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate is CCOC(=O)C(C)Sc1nnc(C)s1.
What is the InChIKey of ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
The InChIKey is LGGJKVYOCWHUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S2/c1-4-12-7(11)5(2)13-8-10-9-6(3)14-8/h5H,4H2,1-3H3.
What are the key properties of ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate?
ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate has a molecular weight of 232.33 g/mol, XLogP of 1.89, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate is sourced from PubChem (CID 3170095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).