C12H13IN4OS2 — CID 23914415
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide (PubChem CID 23914415) has the molecular formula C12H13IN4OS2 and a molecular weight of 420.30 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide |
|---|---|
| PubChem CID | 23914415 |
| Molecular Formula | C12H13IN4OS2 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-iodophenyl)butanamide |
| SMILES | CCC(Sc1nnc(N)s1)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C12H13IN4OS2/c1-2-9(19-12-17-16-11(14)20-12)10(18)15-8-5-3-7(13)4-6-8/h3-6,9H,2H2,1H3,(H2,14,16)(H,15,18) |
| InChIKey | HXZNXQZGLFZBEG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|