C16H18N4O3S2 — CID 2931489
2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-acetylphenyl)butanamide (PubChem CID 2931489) has the molecular formula C16H18N4O3S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-acetylphenyl)butanamide.
| Compound Name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-acetylphenyl)butanamide |
|---|---|
| PubChem CID | 2931489 |
| Molecular Formula | C16H18N4O3S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(4-acetylphenyl)butanamide |
| SMILES | CCC(Sc1nnc(NC(C)=O)s1)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C16H18N4O3S2/c1-4-13(24-16-20-19-15(25-16)17-10(3)22)14(23)18-12-7-5-11(6-8-12)9(2)21/h5-8,13H,4H2,1-3H3,(H,18,23)(H,17,19,22) |
| InChIKey | KVKJWUKAXIJWBM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|