C16H20N4O3S2 — CID 8670194
ethyl (2R)-2-[[5-[(4-methylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate (PubChem CID 8670194) has the molecular formula C16H20N4O3S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is ethyl (2R)-2-[[5-[(4-methylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate.
| Compound Name | ethyl (2R)-2-[[5-[(4-methylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 8670194 |
| Molecular Formula | C16H20N4O3S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | ethyl (2R)-2-[[5-[(4-methylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate |
| SMILES | CCOC(=O)[C@@H](CC)Sc1nnc(NC(=O)Nc2ccc(C)cc2)s1 |
| InChI | InChI=1S/C16H20N4O3S2/c1-4-12(13(21)23-5-2)24-16-20-19-15(25-16)18-14(22)17-11-8-6-10(3)7-9-11/h6-9,12H,4-5H2,1-3H3,(H2,17,18,19,22)/t12-/m1/s1 |
| InChIKey | YSWIEQRIHPVKRV-GFCCVEGCSA-N |
| XLogP | 3.92 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|