C16H20N4O4S2 — CID 7587113
ethyl (2R)-2-[[5-[(4-methoxyphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate (PubChem CID 7587113) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl (2R)-2-[[5-[(4-methoxyphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate.
| Compound Name | ethyl (2R)-2-[[5-[(4-methoxyphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 7587113 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | ethyl (2R)-2-[[5-[(4-methoxyphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate |
| SMILES | CCOC(=O)[C@@H](CC)Sc1nnc(NC(=O)Nc2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C16H20N4O4S2/c1-4-12(13(21)24-5-2)25-16-20-19-15(26-16)18-14(22)17-10-6-8-11(23-3)9-7-10/h6-9,12H,4-5H2,1-3H3,(H2,17,18,19,22)/t12-/m1/s1 |
| InChIKey | QJNFJQICJMSCTE-GFCCVEGCSA-N |
| XLogP | 3.62 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|