C14H16N4O2S3 — CID 3033724
S-[5-[(4-methoxyphenyl)carbamothioylamino]-1,3,4-thiadiazol-2-yl] butanethioate (PubChem CID 3033724) has the molecular formula C14H16N4O2S3 and a molecular weight of 368.51 g/mol. Its IUPAC name is S-[5-[(4-methoxyphenyl)carbamothioylamino]-1,3,4-thiadiazol-2-yl] butanethioate.
| Compound Name | S-[5-[(4-methoxyphenyl)carbamothioylamino]-1,3,4-thiadiazol-2-yl] butanethioate |
|---|---|
| PubChem CID | 3033724 |
| Molecular Formula | C14H16N4O2S3 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | S-[5-[(4-methoxyphenyl)carbamothioylamino]-1,3,4-thiadiazol-2-yl] butanethioate |
| SMILES | CCCC(=O)Sc1nnc(NC(=S)Nc2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C14H16N4O2S3/c1-3-4-11(19)22-14-18-17-13(23-14)16-12(21)15-9-5-7-10(20-2)8-6-9/h5-8H,3-4H2,1-2H3,(H2,15,16,17,21) |
| InChIKey | SRFPDIAGVIBZQQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|