C11H11N3O2S3 — CID 71681556
N-[5-[(4-methoxyphenyl)disulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 71681556) has the molecular formula C11H11N3O2S3 and a molecular weight of 313.43 g/mol. Its IUPAC name is N-[5-[(4-methoxyphenyl)disulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(4-methoxyphenyl)disulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 71681556 |
| Molecular Formula | C11H11N3O2S3 |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | N-[5-[(4-methoxyphenyl)disulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc(SSc2nnc(NC(C)=O)s2)cc1 |
| InChI | InChI=1S/C11H11N3O2S3/c1-7(15)12-10-13-14-11(17-10)19-18-9-5-3-8(16-2)4-6-9/h3-6H,1-2H3,(H,12,13,15) |
| InChIKey | KYWISNMEIKBGKG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|