C14H13N5O3S2 — CID 110656527
N-[5-[[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110656527) has the molecular formula C14H13N5O3S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[5-[[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110656527 |
| Molecular Formula | C14H13N5O3S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N-[5-[[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1cccc(-c2nnc(CSc3nnc(NC(C)=O)s3)o2)c1 |
| InChI | InChI=1S/C14H13N5O3S2/c1-8(20)15-13-18-19-14(24-13)23-7-11-16-17-12(22-11)9-4-3-5-10(6-9)21-2/h3-6H,7H2,1-2H3,(H,15,18,20) |
| InChIKey | VGPWXIVBPQHCBD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|