C15H13N5O5S2 — CID 46390596
N-[5-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide (PubChem CID 46390596) has the molecular formula C15H13N5O5S2 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[5-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide.
| Compound Name | N-[5-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 46390596 |
| Molecular Formula | C15H13N5O5S2 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N-[5-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1nnc(SCc2nnc(-c3ccc4c(c3)OCO4)o2)s1 |
| InChI | InChI=1S/C15H13N5O5S2/c1-22-5-11(21)16-14-19-20-15(27-14)26-6-12-17-18-13(25-12)8-2-3-9-10(4-8)24-7-23-9/h2-4H,5-7H2,1H3,(H,16,19,21) |
| InChIKey | CTVXHNNXZPEOGI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|