C12H11N5O2S2 — CID 7587123
1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-(4-methoxyphenyl)urea (PubChem CID 7587123) has the molecular formula C12H11N5O2S2 and a molecular weight of 321.39 g/mol. Its IUPAC name is 1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 7587123 |
| Molecular Formula | C12H11N5O2S2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2nnc(SCC#N)s2)cc1 |
| InChI | InChI=1S/C12H11N5O2S2/c1-19-9-4-2-8(3-5-9)14-10(18)15-11-16-17-12(21-11)20-7-6-13/h2-5H,7H2,1H3,(H2,14,15,16,18) |
| InChIKey | JZVFWJSXCPJXGU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|