C12H13ClN4O2S2 — CID 7587491
1-(4-chlorophenyl)-3-[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 7587491) has the molecular formula C12H13ClN4O2S2 and a molecular weight of 344.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 7587491 |
| Molecular Formula | C12H13ClN4O2S2 |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[5-(2-methoxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | COCCSc1nnc(NC(=O)Nc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C12H13ClN4O2S2/c1-19-6-7-20-12-17-16-11(21-12)15-10(18)14-9-4-2-8(13)3-5-9/h2-5H,6-7H2,1H3,(H2,14,15,16,18) |
| InChIKey | YASUWMUFBUNZQU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|