C11H10Cl2N4O2S2 — CID 7587689
1-(3,4-dichlorophenyl)-3-[5-(2-hydroxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 7587689) has the molecular formula C11H10Cl2N4O2S2 and a molecular weight of 365.27 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[5-(2-hydroxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[5-(2-hydroxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 7587689 |
| Molecular Formula | C11H10Cl2N4O2S2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[5-(2-hydroxyethylsulfanyl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1nnc(SCCO)s1 |
| InChI | InChI=1S/C11H10Cl2N4O2S2/c12-7-2-1-6(5-8(7)13)14-9(19)15-10-16-17-11(21-10)20-4-3-18/h1-2,5,18H,3-4H2,(H2,14,15,16,19) |
| InChIKey | SAHVGJMXQARJJN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|