C15H16Cl2N4O3S2 — CID 41017476
1-(3,4-dichlorophenyl)-3-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]urea (PubChem CID 41017476) has the molecular formula C15H16Cl2N4O3S2 and a molecular weight of 435.36 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 41017476 |
| Molecular Formula | C15H16Cl2N4O3S2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1nnc(SCCC2OCCCO2)s1 |
| InChI | InChI=1S/C15H16Cl2N4O3S2/c16-10-3-2-9(8-11(10)17)18-13(22)19-14-20-21-15(26-14)25-7-4-12-23-5-1-6-24-12/h2-3,8,12H,1,4-7H2,(H2,18,19,20,22) |
| InChIKey | NZCTWARXZYYVQT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|