C17H22N4O3S2 — CID 7587686
1-(3,4-dimethylphenyl)-3-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]urea (PubChem CID 7587686) has the molecular formula C17H22N4O3S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 7587686 |
| Molecular Formula | C17H22N4O3S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[5-[2-(1,3-dioxan-2-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2nnc(SCCC3OCCCO3)s2)cc1C |
| InChI | InChI=1S/C17H22N4O3S2/c1-11-4-5-13(10-12(11)2)18-15(22)19-16-20-21-17(26-16)25-9-6-14-23-7-3-8-24-14/h4-5,10,14H,3,6-9H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | QVHUFVANZNXDLP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|