C13H13N5OS2 — CID 7587652
1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethylphenyl)urea (PubChem CID 7587652) has the molecular formula C13H13N5OS2 and a molecular weight of 319.42 g/mol. Its IUPAC name is 1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 7587652 |
| Molecular Formula | C13H13N5OS2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-[5-(cyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2nnc(SCC#N)s2)cc1C |
| InChI | InChI=1S/C13H13N5OS2/c1-8-3-4-10(7-9(8)2)15-11(19)16-12-17-18-13(21-12)20-6-5-14/h3-4,7H,6H2,1-2H3,(H2,15,16,17,19) |
| InChIKey | GTCARHKOOYIPQT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|