C17H20N4O4S2 — CID 7587650
ethyl (2S)-2-[[5-[(3,4-dimethylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]-3-oxobutanoate (PubChem CID 7587650) has the molecular formula C17H20N4O4S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is ethyl (2S)-2-[[5-[(3,4-dimethylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl (2S)-2-[[5-[(3,4-dimethylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 7587650 |
| Molecular Formula | C17H20N4O4S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | ethyl (2S)-2-[[5-[(3,4-dimethylphenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](Sc1nnc(NC(=O)Nc2ccc(C)c(C)c2)s1)C(C)=O |
| InChI | InChI=1S/C17H20N4O4S2/c1-5-25-14(23)13(11(4)22)26-17-21-20-16(27-17)19-15(24)18-12-7-6-9(2)10(3)8-12/h6-8,13H,5H2,1-4H3,(H2,18,19,20,24)/t13-/m0/s1 |
| InChIKey | XUULHPHEOFCARX-ZDUSSCGKSA-N |
| XLogP | 3.41 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|