C15H20N4O3S2 — CID 7587721
1-[5-[(2S)-butan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethoxyphenyl)urea (PubChem CID 7587721) has the molecular formula C15H20N4O3S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[5-[(2S)-butan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethoxyphenyl)urea.
| Compound Name | 1-[5-[(2S)-butan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 7587721 |
| Molecular Formula | C15H20N4O3S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 1-[5-[(2S)-butan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethoxyphenyl)urea |
| SMILES | CC[C@H](C)Sc1nnc(NC(=O)Nc2ccc(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C15H20N4O3S2/c1-5-9(2)23-15-19-18-14(24-15)17-13(20)16-10-6-7-11(21-3)12(8-10)22-4/h6-9H,5H2,1-4H3,(H2,16,17,18,20)/t9-/m0/s1 |
| InChIKey | ZVRKJPTVGTTZHZ-VIFPVBQESA-N |
| XLogP | 4.09 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|