C17H23N3O3S3 — CID 8938992
(2R)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3,4-dimethoxyphenyl)propanamide (PubChem CID 8938992) has the molecular formula C17H23N3O3S3 and a molecular weight of 413.59 g/mol. Its IUPAC name is (2R)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | (2R)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 8938992 |
| Molecular Formula | C17H23N3O3S3 |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (2R)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(3,4-dimethoxyphenyl)propanamide |
| SMILES | CCCCSc1nnc(S[C@H](C)C(=O)Nc2ccc(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C17H23N3O3S3/c1-5-6-9-24-16-19-20-17(26-16)25-11(2)15(21)18-12-7-8-13(22-3)14(10-12)23-4/h7-8,10-11H,5-6,9H2,1-4H3,(H,18,21)/t11-/m1/s1 |
| InChIKey | QNHSGSYKUVBBMI-LLVKDONJSA-N |
| XLogP | 4.57 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|