C18H23N3OS3 — CID 8939069
(2S)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,3-dihydro-1H-inden-5-yl)propanamide (PubChem CID 8939069) has the molecular formula C18H23N3OS3 and a molecular weight of 393.60 g/mol. Its IUPAC name is (2S)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,3-dihydro-1H-inden-5-yl)propanamide.
| Compound Name | (2S)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,3-dihydro-1H-inden-5-yl)propanamide |
|---|---|
| PubChem CID | 8939069 |
| Molecular Formula | C18H23N3OS3 |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (2S)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,3-dihydro-1H-inden-5-yl)propanamide |
| SMILES | CCCCSc1nnc(S[C@@H](C)C(=O)Nc2ccc3c(c2)CCC3)s1 |
| InChI | InChI=1S/C18H23N3OS3/c1-3-4-10-23-17-20-21-18(25-17)24-12(2)16(22)19-15-9-8-13-6-5-7-14(13)11-15/h8-9,11-12H,3-7,10H2,1-2H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | PWJSQSUUZZXIMY-LBPRGKRZSA-N |
| XLogP | 5.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|