C14H23N3OS3 — CID 43030011
2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-cyclopentylpropanamide (PubChem CID 43030011) has the molecular formula C14H23N3OS3 and a molecular weight of 345.56 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-cyclopentylpropanamide.
| Compound Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 43030011 |
| Molecular Formula | C14H23N3OS3 |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-cyclopentylpropanamide |
| SMILES | CCCCSc1nnc(SC(C)C(=O)NC2CCCC2)s1 |
| InChI | InChI=1S/C14H23N3OS3/c1-3-4-9-19-13-16-17-14(21-13)20-10(2)12(18)15-11-7-5-6-8-11/h10-11H,3-9H2,1-2H3,(H,15,18) |
| InChIKey | LRJCQBWVSGASAQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|