C13H21N3O3S4 — CID 8938893
(2R)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide (PubChem CID 8938893) has the molecular formula C13H21N3O3S4 and a molecular weight of 395.60 g/mol. Its IUPAC name is (2R)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide.
| Compound Name | (2R)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 8938893 |
| Molecular Formula | C13H21N3O3S4 |
| Molecular Weight | 395.60 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | (2R)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide |
| SMILES | CCCCSc1nnc(S[C@H](C)C(=O)N[C@H]2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C13H21N3O3S4/c1-3-4-6-20-12-15-16-13(22-12)21-9(2)11(17)14-10-5-7-23(18,19)8-10/h9-10H,3-8H2,1-2H3,(H,14,17)/t9-,10+/m1/s1 |
| InChIKey | HJFARWPYAWTDSH-ZJUUUORDSA-N |
| XLogP | 2.21 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.60 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|