C19H26N4OS — CID 8957969
(2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 8957969) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 8957969 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CCCCCn1cnnc1S[C@@H](C)C(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H26N4OS/c1-3-4-5-11-23-13-20-22-19(23)25-14(2)18(24)21-17-10-9-15-7-6-8-16(15)12-17/h9-10,12-14H,3-8,11H2,1-2H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | FQGKFLGVSSOKLD-AWEZNQCLSA-N |
| XLogP | 4.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|