C17H23N5O4S — CID 8957888
(2R)-N-(4-methoxy-2-nitrophenyl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 8957888) has the molecular formula C17H23N5O4S and a molecular weight of 393.47 g/mol. Its IUPAC name is (2R)-N-(4-methoxy-2-nitrophenyl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N-(4-methoxy-2-nitrophenyl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 8957888 |
| Molecular Formula | C17H23N5O4S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (2R)-N-(4-methoxy-2-nitrophenyl)-2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CCCCCn1cnnc1S[C@H](C)C(=O)Nc1ccc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N5O4S/c1-4-5-6-9-21-11-18-20-17(21)27-12(2)16(23)19-14-8-7-13(26-3)10-15(14)22(24)25/h7-8,10-12H,4-6,9H2,1-3H3,(H,19,23)/t12-/m1/s1 |
| InChIKey | HWEDKGIQYUVODO-GFCCVEGCSA-N |
| XLogP | 3.50 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|