C15H18Cl2N4O2S — CID 78759447
N-(2,3-dichlorophenyl)-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 78759447) has the molecular formula C15H18Cl2N4O2S and a molecular weight of 389.31 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 78759447 |
| Molecular Formula | C15H18Cl2N4O2S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | COCCCn1cnnc1SC(C)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H18Cl2N4O2S/c1-10(14(22)19-12-6-3-5-11(16)13(12)17)24-15-20-18-9-21(15)7-4-8-23-2/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,19,22) |
| InChIKey | BINPFRQQTSHRTB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|