C15H19ClFN5O2 — CID 72899413
1-(3-chloro-2-fluorophenyl)-3-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]urea (PubChem CID 72899413) has the molecular formula C15H19ClFN5O2 and a molecular weight of 355.80 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-3-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]urea.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-3-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 72899413 |
| Molecular Formula | C15H19ClFN5O2 |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-3-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]urea |
| SMILES | COCCCn1cnnc1C(C)NC(=O)Nc1cccc(Cl)c1F |
| InChI | InChI=1S/C15H19ClFN5O2/c1-10(14-21-18-9-22(14)7-4-8-24-2)19-15(23)20-12-6-3-5-11(16)13(12)17/h3,5-6,9-10H,4,7-8H2,1-2H3,(H2,19,20,23) |
| InChIKey | HGGFPOFFYMQSQP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|