C14H23F2N5O2 — CID 125436477
4,4-difluoro-N-[(1R)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]piperidine-1-carboxamide (PubChem CID 125436477) has the molecular formula C14H23F2N5O2 and a molecular weight of 331.37 g/mol. Its IUPAC name is 4,4-difluoro-N-[(1R)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]piperidine-1-carboxamide.
| Compound Name | 4,4-difluoro-N-[(1R)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 125436477 |
| Molecular Formula | C14H23F2N5O2 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4,4-difluoro-N-[(1R)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]piperidine-1-carboxamide |
| SMILES | COCCCn1cnnc1[C@@H](C)NC(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H23F2N5O2/c1-11(12-19-17-10-21(12)6-3-9-23-2)18-13(22)20-7-4-14(15,16)5-8-20/h10-11H,3-9H2,1-2H3,(H,18,22)/t11-/m1/s1 |
| InChIKey | ZYBVIGGRXFHDCY-LLVKDONJSA-N |
| XLogP | 1.82 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|