C18H26N6O3 — CID 97433614
N-[3-[[(1R)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]carbamoylamino]-4-methylphenyl]acetamide (PubChem CID 97433614) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[3-[[(1R)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]carbamoylamino]-4-methylphenyl]acetamide.
| Compound Name | N-[3-[[(1R)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]carbamoylamino]-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 97433614 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N-[3-[[(1R)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]carbamoylamino]-4-methylphenyl]acetamide |
| SMILES | COCCCn1cnnc1[C@@H](C)NC(=O)Nc1cc(NC(C)=O)ccc1C |
| InChI | InChI=1S/C18H26N6O3/c1-12-6-7-15(21-14(3)25)10-16(12)22-18(26)20-13(2)17-23-19-11-24(17)8-5-9-27-4/h6-7,10-11,13H,5,8-9H2,1-4H3,(H,21,25)(H2,20,22,26)/t13-/m1/s1 |
| InChIKey | HVKKDDPUODRRGT-CYBMUJFWSA-N |
| XLogP | 2.46 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|