C19H23N5O4 — CID 72931004
1-(4,7-dimethyl-2-oxochromen-6-yl)-3-[1-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]urea (PubChem CID 72931004) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-(4,7-dimethyl-2-oxochromen-6-yl)-3-[1-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]urea.
| Compound Name | 1-(4,7-dimethyl-2-oxochromen-6-yl)-3-[1-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 72931004 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-(4,7-dimethyl-2-oxochromen-6-yl)-3-[1-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]urea |
| SMILES | COCCn1cnnc1C(C)NC(=O)Nc1cc2c(C)cc(=O)oc2cc1C |
| InChI | InChI=1S/C19H23N5O4/c1-11-8-17(25)28-16-7-12(2)15(9-14(11)16)22-19(26)21-13(3)18-23-20-10-24(18)5-6-27-4/h7-10,13H,5-6H2,1-4H3,(H2,21,22,26) |
| InChIKey | QSMFDQMWKUBZKF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|