C19H25N7O2 — CID 97444438
1-(2,3-dimethylquinoxalin-6-yl)-3-[(1S)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]urea (PubChem CID 97444438) has the molecular formula C19H25N7O2 and a molecular weight of 383.46 g/mol. Its IUPAC name is 1-(2,3-dimethylquinoxalin-6-yl)-3-[(1S)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]urea.
| Compound Name | 1-(2,3-dimethylquinoxalin-6-yl)-3-[(1S)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 97444438 |
| Molecular Formula | C19H25N7O2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-(2,3-dimethylquinoxalin-6-yl)-3-[(1S)-1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]urea |
| SMILES | COCCCn1cnnc1[C@H](C)NC(=O)Nc1ccc2nc(C)c(C)nc2c1 |
| InChI | InChI=1S/C19H25N7O2/c1-12-13(2)22-17-10-15(6-7-16(17)21-12)24-19(27)23-14(3)18-25-20-11-26(18)8-5-9-28-4/h6-7,10-11,14H,5,8-9H2,1-4H3,(H2,23,24,27)/t14-/m0/s1 |
| InChIKey | QZJZKWKFFNGLSB-AWEZNQCLSA-N |
| XLogP | 2.76 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|