C17H14F3N5O4S — CID 31613825
(2S)-N-(4-methoxy-2-nitrophenyl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]propanamide (PubChem CID 31613825) has the molecular formula C17H14F3N5O4S and a molecular weight of 441.39 g/mol. Its IUPAC name is (2S)-N-(4-methoxy-2-nitrophenyl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-(4-methoxy-2-nitrophenyl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 31613825 |
| Molecular Formula | C17H14F3N5O4S |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | (2S)-N-(4-methoxy-2-nitrophenyl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]propanamide |
| SMILES | COc1ccc(NC(=O)[C@H](C)Sc2nnc3ccc(C(F)(F)F)cn23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14F3N5O4S/c1-9(15(26)21-12-5-4-11(29-2)7-13(12)25(27)28)30-16-23-22-14-6-3-10(8-24(14)16)17(18,19)20/h3-9H,1-2H3,(H,21,26)/t9-/m0/s1 |
| InChIKey | KAGBRMREILCDGN-VIFPVBQESA-N |
| XLogP | 3.78 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|