C16H20ClN3OS3 — CID 8939030
(2S)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(5-chloro-2-methylphenyl)propanamide (PubChem CID 8939030) has the molecular formula C16H20ClN3OS3 and a molecular weight of 402.01 g/mol. Its IUPAC name is (2S)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(5-chloro-2-methylphenyl)propanamide.
| Compound Name | (2S)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(5-chloro-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 8939030 |
| Molecular Formula | C16H20ClN3OS3 |
| Molecular Weight | 402.01 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | (2S)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(5-chloro-2-methylphenyl)propanamide |
| SMILES | CCCCSc1nnc(S[C@@H](C)C(=O)Nc2cc(Cl)ccc2C)s1 |
| InChI | InChI=1S/C16H20ClN3OS3/c1-4-5-8-22-15-19-20-16(24-15)23-11(3)14(21)18-13-9-12(17)7-6-10(13)2/h6-7,9,11H,4-5,8H2,1-3H3,(H,18,21)/t11-/m0/s1 |
| InChIKey | YXURWCOFQGCYBO-NSHDSACASA-N |
| XLogP | 5.51 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.01 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|