C20H19N3OS3 — CID 43014609
N-(2,3-dihydro-1H-inden-5-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide (PubChem CID 43014609) has the molecular formula C20H19N3OS3 and a molecular weight of 413.59 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 43014609 |
| Molecular Formula | C20H19N3OS3 |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nn(-c2ccccc2)c(=S)s1)C(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H19N3OS3/c1-13(18(24)21-16-11-10-14-6-5-7-15(14)12-16)26-19-22-23(20(25)27-19)17-8-3-2-4-9-17/h2-4,8-13H,5-7H2,1H3,(H,21,24) |
| InChIKey | XSSLXTKZLXAMFD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|