C21H17N3OS3 — CID 40987109
(2S)-N-naphthalen-2-yl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide (PubChem CID 40987109) has the molecular formula C21H17N3OS3 and a molecular weight of 423.59 g/mol. Its IUPAC name is (2S)-N-naphthalen-2-yl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-naphthalen-2-yl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 40987109 |
| Molecular Formula | C21H17N3OS3 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | (2S)-N-naphthalen-2-yl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
| SMILES | C[C@H](Sc1nn(-c2ccccc2)c(=S)s1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H17N3OS3/c1-14(19(25)22-17-12-11-15-7-5-6-8-16(15)13-17)27-20-23-24(21(26)28-20)18-9-3-2-4-10-18/h2-14H,1H3,(H,22,25)/t14-/m0/s1 |
| InChIKey | VBDBXOOJKKNWLQ-AWEZNQCLSA-N |
| XLogP | 5.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|