C17H15N3OS3 — CID 7420009
(2R)-N-phenyl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide (PubChem CID 7420009) has the molecular formula C17H15N3OS3 and a molecular weight of 373.53 g/mol. Its IUPAC name is (2R)-N-phenyl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N-phenyl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 7420009 |
| Molecular Formula | C17H15N3OS3 |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | (2R)-N-phenyl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1nn(-c2ccccc2)c(=S)s1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H15N3OS3/c1-12(15(21)18-13-8-4-2-5-9-13)23-16-19-20(17(22)24-16)14-10-6-3-7-11-14/h2-12H,1H3,(H,18,21)/t12-/m1/s1 |
| InChIKey | CIIYXIIGWKRKFN-GFCCVEGCSA-N |
| XLogP | 4.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|