C17H14N4O3S3 — CID 46792939
N-(2-nitrophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide (PubChem CID 46792939) has the molecular formula C17H14N4O3S3 and a molecular weight of 418.53 g/mol. Its IUPAC name is N-(2-nitrophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-(2-nitrophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 46792939 |
| Molecular Formula | C17H14N4O3S3 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | N-(2-nitrophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nn(-c2ccccc2)c(=S)s1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N4O3S3/c1-11(15(22)18-13-9-5-6-10-14(13)21(23)24)26-16-19-20(17(25)27-16)12-7-3-2-4-8-12/h2-11H,1H3,(H,18,22) |
| InChIKey | CWOBMUHJBMPWTL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|