C11H9N2O2S3- — CID 9484433
(2R)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate (PubChem CID 9484433) has the molecular formula C11H9N2O2S3- and a molecular weight of 297.41 g/mol. Its IUPAC name is (2R)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate.
| Compound Name | (2R)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 9484433 |
| Molecular Formula | C11H9N2O2S3- |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | (2R)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate |
| SMILES | C[C@@H](Sc1nn(-c2ccccc2)c(=S)s1)C(=O)[O-] |
| InChI | InChI=1S/C11H10N2O2S3/c1-7(9(14)15)17-10-12-13(11(16)18-10)8-5-3-2-4-6-8/h2-7H,1H3,(H,14,15)/p-1/t7-/m1/s1 |
| InChIKey | GRWYYEXKOPXVFJ-SSDOTTSWSA-M |
| XLogP | 1.89 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|