C21H24N2OS3 — CID 18291243
1-(1-adamantyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propan-1-one (PubChem CID 18291243) has the molecular formula C21H24N2OS3 and a molecular weight of 416.64 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propan-1-one.
| Compound Name | 1-(1-adamantyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 18291243 |
| Molecular Formula | C21H24N2OS3 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 1-(1-adamantyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]propan-1-one |
| SMILES | CC(Sc1nn(-c2ccccc2)c(=S)s1)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H24N2OS3/c1-13(18(24)21-10-14-7-15(11-21)9-16(8-14)12-21)26-19-22-23(20(25)27-19)17-5-3-2-4-6-17/h2-6,13-16H,7-12H2,1H3 |
| InChIKey | KHZPEHGZWGWXDO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|