C18H17N3OS3 — CID 51209227
N,N-dimethyl-2-phenyl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 51209227) has the molecular formula C18H17N3OS3 and a molecular weight of 387.56 g/mol. Its IUPAC name is N,N-dimethyl-2-phenyl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N,N-dimethyl-2-phenyl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 51209227 |
| Molecular Formula | C18H17N3OS3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N,N-dimethyl-2-phenyl-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | CN(C)C(=O)C(Sc1nn(-c2ccccc2)c(=S)s1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3OS3/c1-20(2)16(22)15(13-9-5-3-6-10-13)24-17-19-21(18(23)25-17)14-11-7-4-8-12-14/h3-12,15H,1-2H3 |
| InChIKey | RIKAFBWFRUUSHO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|